EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27NO8S |
| Net Charge | 0 |
| Average Mass | 501.557 |
| Monoisotopic Mass | 501.14574 |
| SMILES | COc1cc(CSCC(NC(C)=O)C(=O)O)cc2c1-c1c(O)c3c(c(O)c1C2)C(OC)CCC3=O |
| InChI | InChI=1S/C25H27NO8S/c1-11(27)26-15(25(31)32)10-35-9-12-6-13-8-14-20(19(13)18(7-12)34-3)24(30)21-16(28)4-5-17(33-2)22(21)23(14)29/h6-7,15,17,29-30H,4-5,8-10H2,1-3H3,(H,26,27)(H,31,32) |
| InChIKey | XSTMCEQPHBSFEK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (8226325) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cysfluoretin (CHEBI:225382) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| 2-acetamido-3-[(5,10-dihydroxy-4,9-dimethoxy-6-oxo-7,8,9,11-tetrahydrobenzo[b]luoren-2-yl)methylsulanyl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8046325 | ChemSpider |