EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H63N5O8 |
| Net Charge | 0 |
| Average Mass | 717.949 |
| Monoisotopic Mass | 717.46766 |
| SMILES | CCCCCC[C@@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N(C)[C@H](C(=O)N1CCC[C@H]1C(=O)N1C(=O)C=C[C@@H]1C)C(C)C)[C@@H](C)OC(C)=O |
| InChI | InChI=1S/C38H63N5O8/c1-12-13-14-15-17-25(6)35(47)40(10)30(22-23(2)3)34(46)39-32(27(8)51-28(9)44)37(49)41(11)33(24(4)5)38(50)42-21-16-18-29(42)36(48)43-26(7)19-20-31(43)45/h19-20,23-27,29-30,32-33H,12-18,21-22H2,1-11H3,(H,39,46)/t25-,26+,27-,29+,30+,32+,33+/m1/s1 |
| InChIKey | AHUBGMIKOUFGDE-SIMQFNBDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Moorena producens (ncbitaxon:1155739) | - | PubMed (31468974) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microcolin I (CHEBI:225354) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| [(2R,3S)-3-[[(2S)-4-methyl-2-[methyl-[(2R)-2-methyloctanoyl]amino]pentanoyl]amino]-4-[methyl-[(2S)-3-methyl-1-[(2S)-2-[(2S)-2-methyl-5-oxo-2H-pyrrole-1-carbonyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]amino]-4-oxobutan-2-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 81163321 | ChemSpider |