EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H38N4O8.Zn |
| Net Charge | +2 |
| Average Mass | 720.110 |
| Monoisotopic Mass | 718.19701 |
| SMILES | CC1=C(CCC(=O)O)c2cc3nc(cc4nc(cc5nc(cc1n2)c(CCC(=O)O)c5C)c(CCC(=O)O)c4C)C(CCC(=O)O)=C3C.[Zn+2] |
| InChI | InChI=1S/C36H38N4O8.Zn/c1-17-21(5-9-33(41)42)29-14-26-19(3)23(7-11-35(45)46)31(39-26)16-28-20(4)24(8-12-36(47)48)32(40-28)15-27-18(2)22(6-10-34(43)44)30(38-27)13-25(17)37-29;/h13-16,37-38H,5-12H2,1-4H3,(H,41,42)(H,43,44)(H,45,46)(H,47,48);/q;+2/b25-13?,26-14-,27-15-,28-16-,29-14?,30-13-,31-16?,32-15?; |
| InChIKey | KLDGAELFBXYMPF-IGCRFRCISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sphingopyxis (ncbitaxon:165697) | - | PubMed (26306814) |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Zincmethylphyrin I (CHEBI:225353) is a metalloporphyrin (CHEBI:25216) |
| IUPAC Name |
|---|
| zinc;3-[7,12,17-tris(2-carboxyethyl)-3,8,13,18-tetramethyl-21,22-dihydroporphyrin-2-yl]propanoic acid |