EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO3 |
| Net Charge | 0 |
| Average Mass | 289.375 |
| Monoisotopic Mass | 289.16779 |
| SMILES | CC(C)=CCC[C@](C)(O)[C@H]1Cc2cc(C(=O)O)ccc2N1 |
| InChI | InChI=1S/C17H23NO3/c1-11(2)5-4-8-17(3,21)15-10-13-9-12(16(19)20)6-7-14(13)18-15/h5-7,9,15,18,21H,4,8,10H2,1-3H3,(H,19,20)/t15-,17+/m1/s1 |
| InChIKey | ZXXIVRBMWGCUKJ-WBVHZDCISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies RI18 (ncbitaxon:1894972) | - | PubMed (21224859) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JBIR-67 (CHEBI:225336) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (2R)-2-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-2,3-dihydro-1H-indole-5-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78441938 | ChemSpider |