EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10N4O3 |
| Net Charge | 0 |
| Average Mass | 246.226 |
| Monoisotopic Mass | 246.07529 |
| SMILES | Nc1ccc(C(=O)Nc2cc(=O)nc(=O)n2)cc1 |
| InChI | InChI=1S/C11H10N4O3/c12-7-3-1-6(2-4-7)10(17)13-8-5-9(16)15-11(18)14-8/h1-5H,12H2,(H3,13,14,15,16,17,18) |
| InChIKey | NYGJOTVOOGRCAP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (26126744) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-amino-N-(2,4-dioxo-1H-pyrimidin-6-yl)benzamide (CHEBI:225329) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-amino-N-(2,4-dioxo-1H-pyrimidin-6-yl)benzamide |
| Manual Xrefs | Databases |
|---|---|
| 58196510 | ChemSpider |