EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15NO4 |
| Net Charge | 0 |
| Average Mass | 309.321 |
| Monoisotopic Mass | 309.10011 |
| SMILES | O=C(O[C@H](Cc1ccccc1)C(=O)O)c1cnc2ccccc12 |
| InChI | InChI=1S/C18H15NO4/c20-17(21)16(10-12-6-2-1-3-7-12)23-18(22)14-11-19-15-9-5-4-8-13(14)15/h1-9,11,16,19H,10H2,(H,20,21)/t16-/m1/s1 |
| InChIKey | PYVNEMHBMYTTIY-MRXNPFEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusariumspecies L1 (ncbitaxon:1849704) | - | PubMed (33180497) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fusariumindole C (CHEBI:225314) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (2R)-2-(1H-indole-3-carbonyloxy)-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 98309163 | ChemSpider |