EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H41N5O7 |
| Net Charge | 0 |
| Average Mass | 595.697 |
| Monoisotopic Mass | 595.30060 |
| SMILES | CC1CC(=O)OC(C)C(NC(=O)c2ccccc2)C(=O)NC(C)C(=O)N2CCCC2C(=O)N2C=C(CCCC(=O)N1)CC2 |
| InChI | InChI=1S/C31H41N5O7/c1-19-17-26(38)43-21(3)27(34-28(39)23-10-5-4-6-11-23)29(40)33-20(2)30(41)36-15-8-12-24(36)31(42)35-16-14-22(18-35)9-7-13-25(37)32-19/h4-6,10-11,18-21,24,27H,7-9,12-17H2,1-3H3,(H,32,37)(H,33,40)(H,34,39) |
| InChIKey | VDRUBSZESURIAN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium brevicompactum (ncbitaxon:5074) | - | DOI (10.1016/s0040-4020(01)98946-x) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Brevigellin (CHEBI:225312) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| N-(9,13,17-trimethyl-2,8,11,15,19-pentaoxo-14-oxa-1,7,10,18-tetrazatricyclo[21.2.1.03,7]hexacos-23(26)-en-12-yl)benzamide |
| Manual Xrefs | Databases |
|---|---|
| 78444732 | ChemSpider |