EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18N2O2 |
| Net Charge | 0 |
| Average Mass | 318.376 |
| Monoisotopic Mass | 318.13683 |
| SMILES | O=C(Cc1cnc2ccccc12)OCCc1cc2ccccc2n1 |
| InChI | InChI=1S/C20H18N2O2/c23-20(12-15-13-21-19-8-4-2-6-17(15)19)24-10-9-16-11-14-5-1-3-7-18(14)22-16/h1-8,11,13,21-22H,9-10,12H2 |
| InChIKey | ODUMNSRJADHSNG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusariumspecies L1 (ncbitaxon:1849704) | - | PubMed (33180497) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fusariumindole A (CHEBI:225304) is a indole-3-acetic acids (CHEBI:24803) |
| IUPAC Name |
|---|
| 2-(1H-indol-2-yl)ethyl 2-(1H-indol-3-yl)acetate |
| Manual Xrefs | Databases |
|---|---|
| 127510958 | ChemSpider |