EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O5S |
| Net Charge | 0 |
| Average Mass | 216.214 |
| Monoisotopic Mass | 216.00924 |
| SMILES | O=C(O)C(c1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C8H8O5S/c9-8(10)7(14(11,12)13)6-4-2-1-3-5-6/h1-5,7H,(H,9,10)(H,11,12,13) |
| InChIKey | USNMCXDGQQVYSW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-sulfophenylacetic acid (CHEBI:225282) has functional parent phenylacetic acid (CHEBI:30745) |
| α-sulfophenylacetic acid (CHEBI:225282) is a organosulfonic acid (CHEBI:33551) |
| α-sulfophenylacetic acid (CHEBI:225282) is a phenylacetic acids (CHEBI:25978) |
| α-sulfophenylacetic acid (CHEBI:225282) is conjugate acid of α-sulfophenylacetate (CHEBI:59003) |
| Incoming Relation(s) |
| α-sulfophenylacetate (CHEBI:59003) is conjugate base of α-sulfophenylacetic acid (CHEBI:225282) |
| IUPAC Name |
|---|
| phenyl(sulfo)acetic acid |
| Synonyms | Source |
|---|---|
| 2-phenyl-2-sulfoacetic acid | ChEBI |
| α-sulphophenylacetic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2112847 | Reaxys |
| Citations |
|---|