EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N4O5 |
| Net Charge | 0 |
| Average Mass | 414.462 |
| Monoisotopic Mass | 414.19032 |
| SMILES | CC(=O)C(C)Nc1ccc(C(=O)Nc2ccn([C@H]3CC[C@H](O)[C@@H](C)O3)c(=O)n2)cc1 |
| InChI | InChI=1S/C21H26N4O5/c1-12(13(2)26)22-16-6-4-15(5-7-16)20(28)23-18-10-11-25(21(29)24-18)19-9-8-17(27)14(3)30-19/h4-7,10-12,14,17,19,22,27H,8-9H2,1-3H3,(H,23,24,28,29)/t12?,14-,17+,19-/m1/s1 |
| InChIKey | LXOPXDQGRSINGA-WFXCBSHCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (31436991) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Streptcytosine O (CHEBI:225279) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| N-[1-[(2R,5S,6R)-5-hydroxy-6-methyloxan-2-yl]-2-oxopyrimidin-4-yl]-4-(3-oxobutan-2-ylamino)benzamide |
| Manual Xrefs | Databases |
|---|---|
| 81360826 | ChemSpider |