EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30N6O5S |
| Net Charge | 0 |
| Average Mass | 550.641 |
| Monoisotopic Mass | 550.19984 |
| SMILES | CC[C@H](C)C1NC(=O)c2coc(n2)[C@H](C)NC(=O)[C@H]2COC(=N2)[C@@H](Cc2ccccc2)NC(=O)c2csc1n2 |
| InChI | InChI=1S/C27H30N6O5S/c1-4-14(2)21-27-32-20(13-39-27)24(36)29-17(10-16-8-6-5-7-9-16)26-31-18(12-38-26)22(34)28-15(3)25-30-19(11-37-25)23(35)33-21/h5-9,11,13-15,17-18,21H,4,10,12H2,1-3H3,(H,28,34)(H,29,36)(H,33,35)/t14-,15-,17+,18+,21?/m0/s1 |
| InChIKey | PNCLWRPJCHTJRB-ZUTXQSCOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oscillatoria (ncbitaxon:1158) | - | DOI (10.1021/np960115+) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Raocyclamide A (CHEBI:225241) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (4R,8R,11S)-4-benzyl-18-[(2S)-butan-2-yl]-11-methyl-6,13-dioxa-20-thia-3,10,17,22,23,24-hexazatetracyclo[17.2.1.15,8.112,15]tetracosa-1(21),5(24),12(23),14,19(22)-pentaene-2,9,16-trione |
| Manual Xrefs | Databases |
|---|---|
| 78437772 | ChemSpider |