EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19ClO7 |
| Net Charge | 0 |
| Average Mass | 382.796 |
| Monoisotopic Mass | 382.08193 |
| SMILES | COC(=O)c1c(O)cc(OC)c(Cl)c1Oc1c(C)cc(OC)cc1OC |
| InChI | InChI=1S/C18H19ClO7/c1-9-6-10(22-2)7-13(24-4)16(9)26-17-14(18(21)25-5)11(20)8-12(23-3)15(17)19/h6-8,20H,1-5H3 |
| InChIKey | KEIVRVFEHBLNGJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (31359750) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl 3-chloro-2-(2,4-dimethoxy-6-methylphenoxy)-6-hydroxy-4-methoxybenzoate (CHEBI:225228) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| methyl 3-chloro-2-(2,4-dimethoxy-6-methylphenoxy)-6-hydroxy-4-methoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 77429681 | ChemSpider |