EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23ClN4O5 |
| Net Charge | 0 |
| Average Mass | 434.880 |
| Monoisotopic Mass | 434.13570 |
| SMILES | Cn1cc(C2=N[C@](C)(C(=O)N[C@H](C(=O)O)[C@H]3CCCN3)CO2)c2c(O)cc(Cl)cc21 |
| InChI | InChI=1S/C20H23ClN4O5/c1-20(19(29)23-16(18(27)28)12-4-3-5-22-12)9-30-17(24-20)11-8-25(2)13-6-10(21)7-14(26)15(11)13/h6-8,12,16,22,26H,3-5,9H2,1-2H3,(H,23,29)(H,27,28)/t12-,16+,20+/m1/s1 |
| InChIKey | ATUNGSWCIOHXCD-QROBEVECSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1016/j.tetlet.2015.07.080) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JBIR-148 (CHEBI:225219) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(4S)-2-(6-chloro-4-hydroxy-1-methylindol-3-yl)-4-methyl-5H-1,3-oxazole-4-carbonyl]amino]-2-[(2R)-pyrrolidin-2-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 78441922 | ChemSpider |