EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40O6 |
| Net Charge | 0 |
| Average Mass | 496.644 |
| Monoisotopic Mass | 496.28249 |
| SMILES | CC(=C[C@@H]1C[C@H](C)C(=O)O1)[C@H]1C[C@@H](O)[C@]2(C)[C@]1(C)C(=O)C=C1[C@@]3(C)CCC(=O)C(C)(C)[C@@H]3C[C@H]3O[C@@]132 |
| InChI | InChI=1S/C30H40O6/c1-15(10-17-11-16(2)25(34)35-17)18-12-23(33)29(7)28(18,6)22(32)13-20-27(5)9-8-21(31)26(3,4)19(27)14-24-30(20,29)36-24/h10,13,16-19,23-24,33H,8-9,11-12,14H2,1-7H3/t16-,17+,18+,19-,23+,24+,27-,28-,29+,30-/m0/s1 |
| InChIKey | DBCOZDMIVDWFEY-YLQDKSCUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma gibbosum (ncbitaxon:34460) | - | PubMed (31310122) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gibbosicolid C (CHEBI:225196) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (1R,3R,5R,10S,14R,15R,17R,18S)-17-hydroxy-6,6,10,14,18-pentamethyl-15-[1-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]prop-1-en-2-yl]-2-oxapentacyclo[9.7.0.01,3.05,10.014,18]octadec-11-ene-7,13-dione |