EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O9S2 |
| Net Charge | 0 |
| Average Mass | 422.437 |
| Monoisotopic Mass | 422.04537 |
| SMILES | CC(=O)N/C=C/S(=O)C1=C(C(=O)O)N2C(=O)[C@@H](C(C)(C)OS(=O)(=O)O)[C@H]2C1 |
| InChI | InChI=1S/C14H18N2O9S2/c1-7(17)15-4-5-26(21)9-6-8-10(14(2,3)25-27(22,23)24)12(18)16(8)11(9)13(19)20/h4-5,8,10H,6H2,1-3H3,(H,15,17)(H,19,20)(H,22,23,24)/b5-4+/t8-,10+,26?/m1/s1 |
| InChIKey | GOODEIVATWULQD-RTURPLSVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (7251479) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Carpetimycin B (CHEBI:225143) is a carbapenems (CHEBI:46633) |
| IUPAC Name |
|---|
| (5R,6R)-3-[(E)-2-acetamidoethenyl]sulinyl-7-oxo-6-(2-sulooxypropan-2-yl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 16736112 | ChemSpider |