EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27NO9 |
| Net Charge | 0 |
| Average Mass | 497.500 |
| Monoisotopic Mass | 497.16858 |
| SMILES | CC(=O)[C@]1(O)Cc2cc3c(c(O)c2[C@H](O[C@H]2C[C@@H](N)[C@@H](O)[C@@H](C)O2)C1)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C26H27NO9/c1-10-22(30)15(27)7-18(35-10)36-17-9-26(34,11(2)28)8-12-6-14-21(24(32)19(12)17)25(33)20-13(23(14)31)4-3-5-16(20)29/h3-6,10,15,17-18,22,29-30,32,34H,7-9,27H2,1-2H3/t10-,15-,17-,18+,22+,26+/m1/s1 |
| InChIKey | IVTIJSPMQMJSEQ-YZLIVNITSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (6951826) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-O-demethyl-11-deoxydaunorubicin (CHEBI:225091) is a anthracycline (CHEBI:48120) |
| IUPAC Name |
|---|
| (7R,9S)-9-acetyl-7-[(2R,4R,5R,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-4,6,9-trihydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
| Manual Xrefs | Databases |
|---|---|
| 78443288 | ChemSpider |