EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42N4O4 |
| Net Charge | 0 |
| Average Mass | 486.657 |
| Monoisotopic Mass | 486.32061 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@H]([C@@H](C)CC)NC1=O |
| InChI | InChI=1S/C27H42N4O4/c1-7-16(4)21-25(33)28-20(15-19-13-11-10-12-14-19)24(32)29-22(17(5)8-2)26(34)31-23(18(6)9-3)27(35)30-21/h10-14,16-18,20-23H,7-9,15H2,1-6H3,(H,28,33)(H,29,32)(H,30,35)(H,31,34)/t16-,17-,18-,20-,21-,22-,23-/m0/s1 |
| InChIKey | ZRUGSOVQAHAWHC-GSLJADNHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nonomuraea (ncbitaxon:83681) | - | PubMed (19013063) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Wbeta2218 (CHEBI:225060) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (3S,6S,9S,12S)-3-benzyl-6,9,12-tris[(2S)-butan-2-yl]-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 24714804 | ChemSpider |