EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H41N9O11S |
| Net Charge | 0 |
| Average Mass | 687.733 |
| Monoisotopic Mass | 687.26462 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CCCN=C(N)N)[C@H](O)CC(=O)OCC1=C(C(=O)O)N2C(=O)[C@@](NC=O)(NC(=O)CCC[C@@H](N)C(=O)O)[C@H]2SC1 |
| InChI | InChI=1S/C26H41N9O11S/c1-12(27)20(40)33-15(5-3-7-31-25(29)30)16(37)8-18(39)46-9-13-10-47-24-26(32-11-36,23(45)35(24)19(13)22(43)44)34-17(38)6-2-4-14(28)21(41)42/h11-12,14-16,24,37H,2-10,27-28H2,1H3,(H,32,36)(H,33,40)(H,34,38)(H,41,42)(H,43,44)(H4,29,30,31)/t12-,14+,15-,16+,24+,26+/m0/s1 |
| InChIKey | QIKMSWPGMFAWFV-IMEJHETLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Flavobacterium (ncbitaxon:237) | - | PubMed (6549002) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chitinovorin A (CHEBI:224965) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (6R,7R)-7-[[(5R)-5-amino-5-carboxypentanoyl]amino]-3-[[(3R,4S)-4-[[(2S)-2-aminopropanoyl]amino]-7-(diaminomethylideneamino)-3-hydroxyheptanoyl]oxymethyl]-7-ormamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443271 | ChemSpider |