EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32N4O5 |
| Net Charge | 0 |
| Average Mass | 444.532 |
| Monoisotopic Mass | 444.23727 |
| SMILES | CN[C@H]1C=C/C(=C/[C@H](NC(C)=O)C(=O)N[C@@H](/C=C2/C=C[C@H](NC(C)=O)CC2)C(=O)O)CC1 |
| InChI | InChI=1S/C23H32N4O5/c1-14(28)25-19-10-6-17(7-11-19)13-21(23(31)32)27-22(30)20(26-15(2)29)12-16-4-8-18(24-3)9-5-16/h4,6,8,10,12-13,18-21,24H,5,7,9,11H2,1-3H3,(H,25,28)(H,26,29)(H,27,30)(H,31,32)/b16-12-,17-13-/t18-,19-,20-,21-/m0/s1 |
| InChIKey | DXOBDIZQMJWEAT-BMPSSULNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystis aeruginosa (ncbitaxon:1126) | - | PubMed (11374973) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Radiosumin B (CHEBI:224964) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,3E)-3-[(4R)-4-acetamidocyclohex-2-en-1-ylidene]-2-[[(2S,3E)-2-acetamido-3-[(4R)-4-(methylamino)cyclohex-2-en-1-ylidene]propanoyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8518882 | ChemSpider |