EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H50O3 |
| Net Charge | 0 |
| Average Mass | 470.738 |
| Monoisotopic Mass | 470.37600 |
| SMILES | C[C@H]1CC[C@](C)([C@@H](C)[C@H]2CC[C@@]3(C)C4=C(CC[C@]23C)[C@@]2(C)CC[C@H](O)C(C)(C)[C@@H]2CC4)OC1=O |
| InChI | InChI=1S/C31H50O3/c1-19-11-18-31(8,34-26(19)33)20(2)21-12-16-30(7)23-9-10-24-27(3,4)25(32)14-15-28(24,5)22(23)13-17-29(21,30)6/h19-21,24-25,32H,9-18H2,1-8H3/t19-,20-,21+,24-,25-,28+,29+,30-,31+/m0/s1 |
| InChIKey | YSVFUMBQSKJOIN-VKPGBLCESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Astraeus hygrometricus (ncbitaxon:150782) | - | PubMed (22899612) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Astrakurkurone (CHEBI:224962) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (3S,6R)-6-[(1S)-1-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-3,6-dimethyloxan-2-one |
| Manual Xrefs | Databases |
|---|---|
| 78438299 | ChemSpider |