EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48N10O12S |
| Net Charge | 0 |
| Average Mass | 772.839 |
| Monoisotopic Mass | 772.31739 |
| SMILES | CN[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)[C@H](O)CC(=O)OCC1=C(C(=O)O)N2C(=O)[C@@](NC=O)(NC(=O)CCC[C@@H](N)C(=O)O)[C@H]2SC1 |
| InChI | InChI=1S/C30H48N10O12S/c1-14(34-3)23(45)37-15(2)24(46)38-18(7-5-9-35-29(32)33)19(42)10-21(44)52-11-16-12-53-28-30(36-13-41,27(51)40(28)22(16)26(49)50)39-20(43)8-4-6-17(31)25(47)48/h13-15,17-19,28,34,42H,4-12,31H2,1-3H3,(H,36,41)(H,37,45)(H,38,46)(H,39,43)(H,47,48)(H,49,50)(H4,32,33,35)/t14-,15-,17+,18-,19+,28+,30+/m0/s1 |
| InChIKey | ITVAXTXLGSKAIA-HZQFPLSGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Flavobacterium (ncbitaxon:237) | - | PubMed (6549002) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chitinovorin B (CHEBI:224960) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (6R,7R)-7-[[(5R)-5-amino-5-carboxypentanoyl]amino]-3-[[(3R,4S)-7-(diaminomethylideneamino)-3-hydroxy-4-[[(2S)-2-[[(2S)-2-(methylamino)propanoyl]amino]propanoyl]amino]heptanoyl]oxymethyl]-7-ormamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443270 | ChemSpider |