EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20N4O8S |
| Net Charge | 0 |
| Average Mass | 416.412 |
| Monoisotopic Mass | 416.10018 |
| SMILES | N[C@H](CCCC(=O)N[C@]1(NC=O)C(=O)N2C(C(=O)O)=C(CO)CS[C@@H]21)C(=O)O |
| InChI | InChI=1S/C15H20N4O8S/c16-8(11(23)24)2-1-3-9(22)18-15(17-6-21)13(27)19-10(12(25)26)7(4-20)5-28-14(15)19/h6,8,14,20H,1-5,16H2,(H,17,21)(H,18,22)(H,23,24)(H,25,26)/t8-,14-,15-/m1/s1 |
| InChIKey | RQPIYCBIFMMJEJ-KBOAJJQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Flavobacterium (ncbitaxon:237) | - | PubMed (6549002) |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chitinovorin C (CHEBI:224955) is a cephalosporin (CHEBI:23066) |
| IUPAC Name |
|---|
| (6R,7R)-7-[[(5R)-5-amino-5-carboxypentanoyl]amino]-7-ormamido-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 111495 | ChemSpider |