EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24N4O7 |
| Net Charge | 0 |
| Average Mass | 468.466 |
| Monoisotopic Mass | 468.16450 |
| SMILES | O=C(N[C@@H](CO)C(=O)O)c1cc2c(nc3ccccc32)c(CCC(=O)N2CCC[C@H]2C(=O)O)n1 |
| InChI | InChI=1S/C23H24N4O7/c28-11-17(22(31)32)26-21(30)16-10-13-12-4-1-2-5-14(12)25-20(13)15(24-16)7-8-19(29)27-9-3-6-18(27)23(33)34/h1-2,4-5,10,17-18,25,28H,3,6-9,11H2,(H,26,30)(H,31,32)(H,33,34)/t17-,18-/m0/s1 |
| InChIKey | RTIKBNGBTGXMPZ-ROUUACIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycena metata (ncbitaxon:1033252) | - | PubMed (23330951) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Metatacarboline C (CHEBI:224916) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| (2S)-1-[3-[3-[[(1S)-1-carboxy-2-hydroxyethyl]carbamoyl]-9H-pyrido[3,4-b]indol-1-yl]propanoyl]pyrrolidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 58917833 | ChemSpider |