EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H61N5O9 |
| Net Charge | 0 |
| Average Mass | 719.921 |
| Monoisotopic Mass | 719.44693 |
| SMILES | CCCC(=O)NC(C(=O)NC(C(=O)NC(CC(C)C)C(O)CC(=O)NC(C)C(=O)NC(Cc1ccccc1)C(O)CC(=O)OC)C(C)C)C(C)C |
| InChI | InChI=1S/C37H61N5O9/c1-10-14-30(45)41-33(22(4)5)37(50)42-34(23(6)7)36(49)40-26(17-21(2)3)28(43)19-31(46)38-24(8)35(48)39-27(29(44)20-32(47)51-9)18-25-15-12-11-13-16-25/h11-13,15-16,21-24,26-29,33-34,43-44H,10,14,17-20H2,1-9H3,(H,38,46)(H,39,48)(H,40,49)(H,41,45)(H,42,50) |
| InChIKey | KNTOMIYQFLFZLR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (3093433) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ahpatinin A (CHEBI:224895) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl 4-[2-[[4-[[2-[[2-(butanoylamino)-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxy-6-methylheptanoyl]amino]propanoylamino]-3-hydroxy-5-phenylpentanoate |
| Manual Xrefs | Databases |
|---|---|
| 78444951 | ChemSpider |