EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H63N5O9 |
| Net Charge | 0 |
| Average Mass | 733.948 |
| Monoisotopic Mass | 733.46258 |
| SMILES | COC(=O)CC(O)C(Cc1ccccc1)NC(=O)C(C)NC(=O)CC(O)C(CC(C)C)NC(=O)C(NC(=O)C(NC(=O)CC(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C38H63N5O9/c1-21(2)16-27(41-37(50)35(24(7)8)43-38(51)34(23(5)6)42-31(46)17-22(3)4)29(44)19-32(47)39-25(9)36(49)40-28(30(45)20-33(48)52-10)18-26-14-12-11-13-15-26/h11-15,21-25,27-30,34-35,44-45H,16-20H2,1-10H3,(H,39,47)(H,40,49)(H,41,50)(H,42,46)(H,43,51) |
| InChIKey | UIRDINUYOQOXPX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (3093433) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ahpatinin E (CHEBI:224885) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl 3-hydroxy-4-[2-[[3-hydroxy-6-methyl-4-[[3-methyl-2-[[3-methyl-2-(3-methylbutanoylamino)butanoyl]amino]butanoyl]amino]heptanoyl]amino]propanoylamino]-5-phenylpentanoate |
| Manual Xrefs | Databases |
|---|---|
| 78444949 | ChemSpider |