EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H61N5O9 |
| Net Charge | 0 |
| Average Mass | 719.921 |
| Monoisotopic Mass | 719.44693 |
| SMILES | CC(C)CC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](CC(C)C)[C@@H](O)CC(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)[C@H](O)CC(=O)O)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C37H61N5O9/c1-20(2)15-26(28(43)18-31(46)38-24(9)35(49)39-27(16-21(3)4)29(44)19-32(47)48)40-36(50)33(23(7)8)42-37(51)34(25-13-11-10-12-14-25)41-30(45)17-22(5)6/h10-14,20-24,26-29,33-34,43-44H,15-19H2,1-9H3,(H,38,46)(H,39,49)(H,40,50)(H,41,45)(H,42,51)(H,47,48)/t24-,26+,27-,28-,29+,33-,34-/m0/s1 |
| InChIKey | MRXGDZORFRGURD-NRTIAEHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (3093433) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ahpatinin F (CHEBI:224880) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (3R,4S)-3-hydroxy-4-[[(2S)-2-[[(3S,4R)-3-hydroxy-6-methyl-4-[[(2S)-3-methyl-2-[[(2S)-2-(3-methylbutanoylamino)-2-phenylacetyl]amino]butanoyl]amino]heptanoyl]amino]propanoyl]amino]-6-methylheptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443264 | ChemSpider |