EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H61N5O9 |
| Net Charge | 0 |
| Average Mass | 767.965 |
| Monoisotopic Mass | 767.44693 |
| SMILES | COC(=O)CC(O)C(Cc1ccccc1)NC(=O)C(C)NC(=O)CC(O)C(Cc1ccccc1)NC(=O)C(NC(=O)C(NC(=O)CC(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C41H61N5O9/c1-24(2)19-34(49)45-37(25(3)4)41(54)46-38(26(5)6)40(53)44-30(20-28-15-11-9-12-16-28)32(47)22-35(50)42-27(7)39(52)43-31(33(48)23-36(51)55-8)21-29-17-13-10-14-18-29/h9-18,24-27,30-33,37-38,47-48H,19-23H2,1-8H3,(H,42,50)(H,43,52)(H,44,53)(H,45,49)(H,46,54) |
| InChIKey | MFWIJLUBDHGRLX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (3093433) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ahpatinin G (CHEBI:224877) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl 3-hydroxy-4-[2-[[3-hydroxy-4-[[3-methyl-2-[[3-methyl-2-(3-methylbutanoylamino)butanoyl]amino]butanoyl]amino]-5-phenylpentanoyl]amino]propanoylamino]-5-phenylpentanoate |
| Manual Xrefs | Databases |
|---|---|
| 78444948 | ChemSpider |