EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O4 |
| Net Charge | 0 |
| Average Mass | 382.500 |
| Monoisotopic Mass | 382.21441 |
| SMILES | C/C=C(\C)[C@]1(O)C=C[C@@H]2CC(C)=CC[C@H]2[C@]1(O)/C=C/C=C\C=C\C=C\C(=O)O |
| InChI | InChI=1S/C24H30O4/c1-4-19(3)23(27)16-14-20-17-18(2)12-13-21(20)24(23,28)15-10-8-6-5-7-9-11-22(25)26/h4-12,14-16,20-21,27-28H,13,17H2,1-3H3,(H,25,26)/b7-5+,8-6-,11-9+,15-10+,19-4+/t20-,21-,23-,24-/m1/s1 |
| InChIKey | WUNXOGJUDRVVDA-PPEXVTMASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plenodomus enteroleucus (ncbitaxon:1077365) | - | PubMed (32881504) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Campafungin D (CHEBI:224804) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6Z,8E)-9-[(1R,2R,4aS,8aR)-2-[(E)-but-2-en-2-yl]-1,2-dihydroxy-6-methyl-4a,5,8,8a-tetrahydronaphthalen-1-yl]nona-2,4,6,8-tetraenoic acid |