EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O4 |
| Net Charge | 0 |
| Average Mass | 382.500 |
| Monoisotopic Mass | 382.21441 |
| SMILES | C/C=C(\C)[C@@]1(O)[C@@H](/C=C/C=C/C=C/C=C/C(=O)O)[C@@H]2CC=C(C)C[C@H]2[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C24H30O4/c1-4-17(3)24(27)20(11-9-7-5-6-8-10-12-21(25)26)18-14-13-16(2)15-19(18)22-23(24)28-22/h4-13,18-20,22-23,27H,14-15H2,1-3H3,(H,25,26)/b7-5+,8-6+,11-9+,12-10+,17-4+/t18-,19-,20+,22+,23+,24-/m1/s1 |
| InChIKey | QVAWIGOWYGZSNR-RURWRFGGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plenodomus enteroleucus (ncbitaxon:1077365) | - | PubMed (32881504) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Campafungin B (CHEBI:224795) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6E,8E)-9-[(1aS,2S,3S,3aR,7aR,7bS)-2-[(E)-but-2-en-2-yl]-2-hydroxy-6-methyl-3,3a,4,7,7a,7b-hexahydro-1aH-naphtho[1,2-b]oxiren-3-yl]nona-2,4,6,8-tetraenoic acid |