EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H18O9 |
| Net Charge | 0 |
| Average Mass | 438.388 |
| Monoisotopic Mass | 438.09508 |
| SMILES | COC(=O)/C(=C\c1ccc(O)c(O)c1)c1c(O)cc(/C=C/c2ccc(O)c(O)c2)oc1=O |
| InChI | InChI=1S/C23H18O9/c1-31-22(29)15(8-13-4-7-17(25)19(27)10-13)21-20(28)11-14(32-23(21)30)5-2-12-3-6-16(24)18(26)9-12/h2-11,24-28H,1H3/b5-2+,15-8- |
| InChIKey | KSCNEEIWGUYULB-GMKMYQCMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phellinus xeranticus (ncbitaxon:1143127) | - | PubMed (17387019) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Interfungin C (CHEBI:224744) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| methyl (Z)-3-(3,4-dihydroxyphenyl)-2-[6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxy-2-oxopyran-3-yl]prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 23283930 | ChemSpider |