EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44N4O7 |
| Net Charge | 0 |
| Average Mass | 536.670 |
| Monoisotopic Mass | 536.32100 |
| SMILES | CCCCCCC/C=C/C=C/C(=O)N[C@@H](C(=O)N[C@H]1C[C@@H](O)CCNC(=O)/C=C\[C@H](CO)NC1=O)[C@@H](C)O |
| InChI | InChI=1S/C27H44N4O7/c1-3-4-5-6-7-8-9-10-11-12-24(36)31-25(19(2)33)27(38)30-22-17-21(34)15-16-28-23(35)14-13-20(18-32)29-26(22)37/h9-14,19-22,25,32-34H,3-8,15-18H2,1-2H3,(H,28,35)(H,29,37)(H,30,38)(H,31,36)/b10-9+,12-11+,14-13-/t19-,20-,21+,22+,25-/m1/s1 |
| InChIKey | IHONJNBUCZLUOS-PPTJONKGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Polyangium (ncbitaxon:55) | - | PubMed (3145259) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glidobactin G (CHEBI:224723) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (2E,4E)-N-[(2R,3R)-3-hydroxy-1-[[(3Z,5R,8S,10S)-10-hydroxy-5-(hydroxymethyl)-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]amino]-1-oxobutan-2-yl]dodeca-2,4-dienamide |
| Manual Xrefs | Databases |
|---|---|
| 78443239 | ChemSpider |