EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17N5S |
| Net Charge | 0 |
| Average Mass | 227.337 |
| Monoisotopic Mass | 227.12047 |
| SMILES | CCNc1nc(NC(C)C)nc(SC)n1 |
| InChI | InChI=1S/C9H17N5S/c1-5-10-7-12-8(11-6(2)3)14-9(13-7)15-4/h6H,5H2,1-4H3,(H2,10,11,12,13,14) |
| InChIKey | RQVYBGPQFYCBGX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ametryn (CHEBI:22472) has role environmental contaminant (CHEBI:78298) |
| ametryn (CHEBI:22472) has role herbicide (CHEBI:24527) |
| ametryn (CHEBI:22472) is a diamino-1,3,5-triazine (CHEBI:38170) |
| ametryn (CHEBI:22472) is a methylthio-1,3,5-triazine (CHEBI:38174) |
| IUPAC Name |
|---|
| N2-ethyl-N4-isopropyl-6-(methylthio)-1,3,5-triazine-2,4-diamine |
| Synonyms | Source |
|---|---|
| N-ethyl-6-(methylsulfanyl)-N'-(propan-2-yl)-1,3,5-triazine-2,4-diamine | IUPAC |
| ametryne | ChemIDplus |
| N-ethyl-N'-(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine | NIST Chemistry WebBook |
| ametryn | UM-BBD |
| N-ethyl-N'-(1-methylethyl)-6-(methylthio)-2,4-diaminetriazine | UM-BBD |
| 2-(methylthio)-4-(ethylamino)-6-(isopropylamino)-s-triazine | NIST Chemistry WebBook |
| Citations |
|---|