EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O4 |
| Net Charge | 0 |
| Average Mass | 260.289 |
| Monoisotopic Mass | 260.10486 |
| SMILES | C[C@H](CO)[C@H]1CCc2coc3cc(C(=O)O)cc1c23 |
| InChI | InChI=1S/C15H16O4/c1-8(6-16)11-3-2-9-7-19-13-5-10(15(17)18)4-12(11)14(9)13/h4-5,7-8,11,16H,2-3,6H2,1H3,(H,17,18)/t8-,11-/m1/s1 |
| InChIKey | NJYGTKDUQVRJAI-LDYMZIIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichoderma (ncbitaxon:5543) | - | PubMed (31418264) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trichocadinin C (CHEBI:224698) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| (7R)-7-[(2S)-1-hydroxypropan-2-yl]-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-10-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 128439855 | ChemSpider |