EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N4O4 |
| Net Charge | 0 |
| Average Mass | 258.278 |
| Monoisotopic Mass | 258.13281 |
| SMILES | NC(=O)N1C[C@@H](C[C@H](O)CCCC(=O)O)N=C1N |
| InChI | InChI=1S/C10H18N4O4/c11-9-13-6(5-14(9)10(12)18)4-7(15)2-1-3-8(16)17/h6-7,15H,1-5H2,(H2,11,13)(H2,12,18)(H,16,17)/t6-,7-/m1/s1 |
| InChIKey | CXRAZENRYGPIMC-RNFRBKRXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies K01-0509 (ncbitaxon:1238679) | - | PubMed (18503202) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guadinomic acid (CHEBI:224690) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (5R)-6-[(4R)-2-amino-1-carbamoyl-4,5-dihydroimidazol-4-yl]-5-hydroxyhexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 13081384 | ChemSpider |