EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O3 |
| Net Charge | 0 |
| Average Mass | 244.290 |
| Monoisotopic Mass | 244.10994 |
| SMILES | CC(C)[C@H]1CCc2coc3cc(C(=O)O)cc1c23 |
| InChI | InChI=1S/C15H16O3/c1-8(2)11-4-3-9-7-18-13-6-10(15(16)17)5-12(11)14(9)13/h5-8,11H,3-4H2,1-2H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | FHHBRHPDGKEYIF-LLVKDONJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichoderma (ncbitaxon:5543) | - | PubMed (31418264) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trichocadinin B (CHEBI:224677) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| (7R)-7-propan-2-yl-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-10-carboxylic acid |