EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O6 |
| Net Charge | 0 |
| Average Mass | 290.271 |
| Monoisotopic Mass | 290.07904 |
| SMILES | COc1cc(O)cc2c1C(=O)C1=C(C[C@@](C)(O)OC1)C2=O |
| InChI | InChI=1S/C15H14O6/c1-15(19)5-9-10(6-21-15)14(18)12-8(13(9)17)3-7(16)4-11(12)20-2/h3-4,16,19H,5-6H2,1-2H3/t15-/m0/s1 |
| InChIKey | OHQMZDGELJCFFD-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Corynespora (ncbitaxon:59585) | - | PubMed (20521776) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-desmethylherbarin (CHEBI:224661) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| 3,7-dihydroxy-9-methoxy-3-methyl-1,4-dihydrobenzo[g]isochromene-5,10-dione |
| Manual Xrefs | Databases |
|---|---|
| 78436006 | ChemSpider |