EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H21N3O3 |
| Net Charge | 0 |
| Average Mass | 387.439 |
| Monoisotopic Mass | 387.15829 |
| SMILES | CC(=O)c1nc(C(=O)NC[C@H](O)c2ccccc2)cc2c3ccccc3n(C)c12 |
| InChI | InChI=1S/C23H21N3O3/c1-14(27)21-22-17(16-10-6-7-11-19(16)26(22)2)12-18(25-21)23(29)24-13-20(28)15-8-4-3-5-9-15/h3-12,20,28H,13H2,1-2H3,(H,24,29)/t20-/m0/s1 |
| InChIKey | GILQWUONLGMUBN-FQEVSTJZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinoalloteichus (ncbitaxon:65496) | - | PubMed (32864967) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Marinacarboline N (CHEBI:224640) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1-acetyl-N-[(2R)-2-hydroxy-2-phenylethyl]-9-methylpyrido[3,4-b]indole-3-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 92172162 | ChemSpider |