EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O2 |
| Net Charge | 0 |
| Average Mass | 398.631 |
| Monoisotopic Mass | 398.31848 |
| SMILES | C=C(C/C=C\[C@H]1CC[C@H]2C3=CC[C@H]4C[C@@H](O)CC[C@]4(CO)[C@H]3CC[C@]12C)C(C)C |
| InChI | InChI=1S/C27H42O2/c1-18(2)19(3)6-5-7-20-9-11-24-23-10-8-21-16-22(29)12-15-27(21,17-28)25(23)13-14-26(20,24)4/h5,7,10,18,20-22,24-25,28-29H,3,6,8-9,11-17H2,1-2,4H3/b7-5-/t20-,21-,22-,24-,25-,26+,27+/m0/s1 |
| InChIKey | MGUPDIUDFLRFKN-CZJUOIDJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptosporiopsis (ncbitaxon:108533) | - | DOI (10.1016/0040-4039(95)01598-1) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Abscisterol F (CHEBI:224609) has role androgen (CHEBI:50113) |
| Abscisterol F (CHEBI:224609) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (3S,5S,9S,10R,13R,14R,17R)-10-(hydroxymethyl)-13-methyl-17-[(Z)-5-methyl-4-methylidenehex-1-enyl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Manual Xrefs | Databases |
|---|---|
| 78438289 | ChemSpider |