EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42N4O6 |
| Net Charge | 0 |
| Average Mass | 506.644 |
| Monoisotopic Mass | 506.31044 |
| SMILES | CC(C)CCC/C=C\C=C\C(=O)N[C@@H](C(=O)N[C@@H]1C[C@H](O)CCNC(=O)/C=C\[C@H](C)NC1=O)[C@@H](C)O |
| InChI | InChI=1S/C26H42N4O6/c1-17(2)10-8-6-5-7-9-11-23(34)30-24(19(4)31)26(36)29-21-16-20(32)14-15-27-22(33)13-12-18(3)28-25(21)35/h5,7,9,11-13,17-21,24,31-32H,6,8,10,14-16H2,1-4H3,(H,27,33)(H,28,35)(H,29,36)(H,30,34)/b7-5-,11-9+,13-12-/t18-,19+,20+,21+,24+/m0/s1 |
| InChIKey | ZQOSECHKDTUIEK-UJSSYPEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas (ncbitaxon:286) | - | PubMed (2387772) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cepafungin III (CHEBI:224608) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (2E,4Z)-N-[(2R,3R)-3-hydroxy-1-[[(3Z,5S,8R,10R)-10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]amino]-1-oxobutan-2-yl]-9-methyldeca-2,4-dienamide |
| Manual Xrefs | Databases |
|---|---|
| 78443226 | ChemSpider |