EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O9 |
| Net Charge | 0 |
| Average Mass | 448.428 |
| Monoisotopic Mass | 448.14818 |
| SMILES | COc1ccc(C=C2C(=O)N[C@@]3(C[C@]4(O)[C@H](C=C[C@@H](O)[C@@H]4O)O3)C(=O)N2C)c(O)c1OC |
| InChI | InChI=1S/C21H24N2O9/c1-23-11(8-10-4-6-13(30-2)16(31-3)15(10)25)18(27)22-21(19(23)28)9-20(29)14(32-21)7-5-12(24)17(20)26/h4-8,12,14,17,24-26,29H,9H2,1-3H3,(H,22,27)/t12-,14+,17+,20+,21-/m1/s1 |
| InChIKey | HCKQCACCKTUAQG-NSBANYLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (32816473) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penispirozine G (CHEBI:224585) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2R,3aR,4S,5R,7aS)-3a,4,5-trihydroxy-6'-[(2-hydroxy-3,4-dimethoxyphenyl)methylidene]-1'-methylspiro[3,4,5,7a-tetrahydro-1-benzouran-2,3'-piperazine]-2',5'-dione |