EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N2O9 |
| Net Charge | 0 |
| Average Mass | 434.401 |
| Monoisotopic Mass | 434.13253 |
| SMILES | COc1ccc(C=C2NC(=O)[C@@]3(C[C@]4(O)[C@@H](C=C[C@@H](O)[C@@H]4O)O3)NC2=O)c(O)c1OC |
| InChI | InChI=1S/C20H22N2O9/c1-29-12-5-3-9(14(24)15(12)30-2)7-10-17(26)22-20(18(27)21-10)8-19(28)13(31-20)6-4-11(23)16(19)25/h3-7,11,13,16,23-25,28H,8H2,1-2H3,(H,21,27)(H,22,26)/t11-,13-,16+,19+,20+/m1/s1 |
| InChIKey | SVZSHNMALOJOKU-JKRAONCPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (32816473) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penispirozine F (CHEBI:224580) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S,3aR,4S,5R,7aR)-3a,4,5-trihydroxy-6'-[(2-hydroxy-3,4-dimethoxyphenyl)methylidene]spiro[3,4,5,7a-tetrahydro-1-benzouran-2,3'-piperazine]-2',5'-dione |