EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10O5 |
| Net Charge | 0 |
| Average Mass | 222.196 |
| Monoisotopic Mass | 222.05282 |
| SMILES | C=C(Oc1cccc(C(=O)OC)c1)C(=O)O |
| InChI | InChI=1S/C11H10O5/c1-7(10(12)13)16-9-5-3-4-8(6-9)11(14)15-2/h3-6H,1H2,2H3,(H,12,13) |
| InChIKey | DRIONLYHLHLYGJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomiumspecies (ncbitaxon:1769349) | - | DOI (10.1016/j.tet.2016.08.022) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chorismeron (CHEBI:224563) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2-(3-methoxycarbonylphenoxy)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78434929 | ChemSpider |