EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H33ClN8O6S |
| Net Charge | 0 |
| Average Mass | 705.197 |
| Monoisotopic Mass | 704.19323 |
| SMILES | COC(=O)[C@]12S[C@@]3(C[C@]4(n5cc(C[C@]67NCCN[C@](Cl)(C(=O)N6C)N(C)C7=O)c6ccccc65)c5ccccc5N[C@@H]4N3C1=O)C(=O)N2C |
| InChI | InChI=1S/C33H33ClN8O6S/c1-38-27(46)33(34)36-14-13-35-30(38,24(43)40(33)3)15-18-16-41(22-12-8-5-9-19(18)22)29-17-31-25(44)39(2)32(49-31,28(47)48-4)26(45)42(31)23(29)37-21-11-7-6-10-20(21)29/h5-12,16,23,35-37H,13-15,17H2,1-4H3/t23-,29+,30+,31+,32-,33-/m1/s1 |
| InChIKey | ZJAMJWFUUCXRPN-QTBUGMRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Subramaniula cristata (ncbitaxon:1934347) | - | PubMed (26726745) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cristazine (CHEBI:224510) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| methyl (1S,3S,11R,14R)-3-[3-[[(1S,6R)-6-chloro-7,9-dimethyl-8,10-dioxo-2,5,7,9-tetrazabicyclo[4.2.2]decan-1-yl]methyl]indol-1-yl]-15-methyl-13,16-dioxo-17-thia-10,12,15-triazapentacyclo[12.2.1.01,12.03,11.04,9]heptadeca-4,6,8-triene-14-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78439816 | ChemSpider |