EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H33NO9 |
| Net Charge | 0 |
| Average Mass | 527.570 |
| Monoisotopic Mass | 527.21553 |
| SMILES | CCC1(O)CC(O[C@H]2C[C@H](N(C)C)[C@H](O)[C@H](C)O2)c2cc3c(c(O)c2C1O)C(=O)c1cccc(O)c1C3=O |
| InChI | InChI=1S/C28H33NO9/c1-5-28(36)11-18(38-19-10-16(29(3)4)23(31)12(2)37-19)14-9-15-21(26(34)22(14)27(28)35)24(32)13-7-6-8-17(30)20(13)25(15)33/h6-9,12,16,18-19,23,27,30-31,34-36H,5,10-11H2,1-4H3/t12-,16-,18?,19-,23+,27?,28?/m0/s1 |
| InChIKey | ORPXAKRJDMYLPY-DCDGKKTRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces violaceus (ncbitaxon:1936) | - | PubMed (1955394) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Yellamycin A (CHEBI:224499) is a anthracycline (CHEBI:48120) |
| IUPAC Name |
|---|
| 7-[(2R,4S,5S,6S)-4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-9-ethyl-4,9,10,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
| Manual Xrefs | Databases |
|---|---|
| 163192 | ChemSpider |