EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | C=C[C@]1(C)CC[C@@]2(O)[C@](O)(CC[C@]3(O)[C@]2(C)CCC[C@]3(C)C(=O)O)C1 |
| InChI | InChI=1S/C20H32O5/c1-5-15(2)9-11-20(25)17(4)8-6-7-16(3,14(21)22)19(17,24)12-10-18(20,23)13-15/h5,23-25H,1,6-13H2,2-4H3,(H,21,22)/t15-,16-,17+,18+,19-,20+/m1/s1 |
| InChIKey | BNRGQJJEHAUBMN-JWLCQNFESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces (ncbitaxon:5094) | - | PubMed (32813522) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Talascortene C (CHEBI:224470) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1S,4aS,4bS,7R,8aS,10aS)-7-ethenyl-4b,8a,10a-trihydroxy-1,4a,7-trimethyl-2,3,4,5,6,8,9,10-octahydrophenanthrene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 90609332 | ChemSpider |