EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19ClO6 |
| Net Charge | 0 |
| Average Mass | 366.797 |
| Monoisotopic Mass | 366.08702 |
| SMILES | C[C@@H]1C[C@H]2O[C@@H]2CC/C=C/C(=O)Cc2c(Cl)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H19ClO6/c1-9-6-15-14(25-15)5-3-2-4-10(20)7-11-16(18(23)24-9)12(21)8-13(22)17(11)19/h2,4,8-9,14-15,21-22H,3,5-7H2,1H3/b4-2+/t9-,14-,15-/m1/s1 |
| InChIKey | WUSYBKJSCTYKMV-WSLUJDFDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pochonia (ncbitaxon:243023) | - | PubMed (12828470) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pochonin A (CHEBI:224462) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (4R,6R,8R,11E)-16-chloro-17,19-dihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione |
| Manual Xrefs | Databases |
|---|---|
| 28283081 | ChemSpider |