EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O3 |
| Net Charge | 0 |
| Average Mass | 330.468 |
| Monoisotopic Mass | 330.21949 |
| SMILES | CC(=CCO)[C@@H]1C(C)=C[C@@H]2CCC[C@H](C)[C@H]2[C@@H]1/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C21H30O3/c1-14-7-6-8-17-13-16(3)20(15(2)11-12-22)18(21(14)17)9-4-5-10-19(23)24/h4-5,9-11,13-14,17-18,20-22H,6-8,12H2,1-3H3,(H,23,24)/b9-4+,10-5+,15-11?/t14-,17-,18+,20+,21+/m0/s1 |
| InChIKey | ZAVTXWWFRUFGIQ-LZGZPVOOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomopsis (ncbitaxon:34399) | - | PubMed (32686414) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Carneic acid J (CHEBI:224407) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(1S,2S,4aR,8S,8aR)-2-(4-hydroxybut-2-en-2-yl)-3,8-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]penta-2,4-dienoic acid |