EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O4 |
| Net Charge | 0 |
| Average Mass | 346.467 |
| Monoisotopic Mass | 346.21441 |
| SMILES | CC(=CCO)[C@@H]1C(C)=C[C@@H]2CC[C@@H](O)[C@H](C)[C@H]2[C@@H]1/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C21H30O4/c1-13(10-11-22)20-14(2)12-16-8-9-18(23)15(3)21(16)17(20)6-4-5-7-19(24)25/h4-7,10,12,15-18,20-23H,8-9,11H2,1-3H3,(H,24,25)/b6-4+,7-5+,13-10?/t15-,16-,17+,18+,20+,21+/m0/s1 |
| InChIKey | HTHAYLBBJFVVFW-IUXUBPQJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomopsis (ncbitaxon:34399) | - | PubMed (32686414) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Carneic acid I (CHEBI:224402) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(1S,2S,4aR,7R,8R,8aR)-7-hydroxy-2-(4-hydroxybut-2-en-2-yl)-3,8-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]penta-2,4-dienoic acid |