EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O4 |
| Net Charge | 0 |
| Average Mass | 286.327 |
| Monoisotopic Mass | 286.12051 |
| SMILES | COc1ccc([C@@H]2CCc3ccc(O)c(C)c3O2)cc1O |
| InChI | InChI=1S/C17H18O4/c1-10-13(18)6-3-11-4-7-15(21-17(10)11)12-5-8-16(20-2)14(19)9-12/h3,5-6,8-9,15,18-19H,4,7H2,1-2H3/t15-/m0/s1 |
| InChIKey | XVHKLOFEZNFSRF-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,3'-dihydroxy-4'-methoxy-8-methylflavan (CHEBI:2244) has parent hydride (2S)-flavan (CHEBI:36103) |
| 7,3'-dihydroxy-4'-methoxy-8-methylflavan (CHEBI:2244) has role plant metabolite (CHEBI:76924) |
| 7,3'-dihydroxy-4'-methoxy-8-methylflavan (CHEBI:2244) is a hydroxyflavan (CHEBI:72010) |
| 7,3'-dihydroxy-4'-methoxy-8-methylflavan (CHEBI:2244) is a methoxyflavan (CHEBI:72585) |
| IUPAC Name |
|---|
| (2S)-2-(3-hydroxy-4-methoxyphenyl)-8-methyl-3,4-dihydro-2H-1-benzopyran-7-ol |
| Manual Xrefs | Databases |
|---|---|
| C00000952 | KNApSAcK |
| C09646 | KEGG COMPOUND |
| LMPK12020239 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5575798 | Reaxys |
| CAS:87733-81-1 | KEGG COMPOUND |