EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36O6 |
| Net Charge | 0 |
| Average Mass | 456.579 |
| Monoisotopic Mass | 456.25119 |
| SMILES | CCC(C)[C@@H]1O[C@@]1(C)[C@]1(O)C(C)=C[C@@H]2CC(C(=O)OC)=CC[C@H]2[C@@H]1/C=C/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C27H36O6/c1-6-17(2)24-26(4,33-24)27(31)18(3)15-20-16-19(25(30)32-5)13-14-21(20)22(27)11-9-7-8-10-12-23(28)29/h7-13,15,17,20-22,24,31H,6,14,16H2,1-5H3,(H,28,29)/b8-7+,11-9+,12-10+/t17?,20-,21-,22+,24+,26-,27+/m1/s1 |
| InChIKey | MKFMCRKTWMJGHB-VZTPWLLHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladobotryumspecies (ncbitaxon:2040732) | - | PubMed (16266122) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| F2928-2 (CHEBI:224390) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6E)-7-[(1S,2R,4aR,8aR)-2-[(2R,3S)-3-butan-2-yl-2-methyloxiran-2-yl]-2-hydroxy-6-methoxycarbonyl-3-methyl-4a,5,8,8a-tetrahydro-1H-naphthalen-1-yl]hepta-2,4,6-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438284 | ChemSpider |